C17H19N3O2S — CID 126840631
3-benzyl-1-methyl-2-oxo-N-(1,3-thiazol-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 126840631) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 3-benzyl-1-methyl-2-oxo-N-(1,3-thiazol-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | 3-benzyl-1-methyl-2-oxo-N-(1,3-thiazol-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126840631 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 3-benzyl-1-methyl-2-oxo-N-(1,3-thiazol-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | CN1CCC(Cc2ccccc2)(C(=O)NCc2nccs2)C1=O |
| InChI | InChI=1S/C17H19N3O2S/c1-20-9-7-17(16(20)22,11-13-5-3-2-4-6-13)15(21)19-12-14-18-8-10-23-14/h2-6,8,10H,7,9,11-12H2,1H3,(H,19,21) |
| InChIKey | DORYBQGNSQBAMI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|