C20H20N2O2S — CID 126842701
N,N-dimethyl-4-(4-methylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine (PubChem CID 126842701) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-methylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine.
| Compound Name | N,N-dimethyl-4-(4-methylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
|---|---|
| PubChem CID | 126842701 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N,N-dimethyl-4-(4-methylphenyl)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-amine |
| SMILES | Cc1ccc(C2NS(=O)(=O)c3cccc4c(N(C)C)ccc2c34)cc1 |
| InChI | InChI=1S/C20H20N2O2S/c1-13-7-9-14(10-8-13)20-16-11-12-17(22(2)3)15-5-4-6-18(19(15)16)25(23,24)21-20/h4-12,20-21H,1-3H3 |
| InChIKey | HQHMFXZCQFFWKO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |