C19H18N2O3S — CID 126842702
4-[8-(dimethylamino)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-4-yl]phenol (PubChem CID 126842702) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is 4-[8-(dimethylamino)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-4-yl]phenol.
| Compound Name | 4-[8-(dimethylamino)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-4-yl]phenol |
|---|---|
| PubChem CID | 126842702 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4-[8-(dimethylamino)-2,2-dioxo-2λ6-thia-3-azatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-4-yl]phenol |
| SMILES | CN(C)c1ccc2c3c(cccc13)S(=O)(=O)NC2c1ccc(O)cc1 |
| InChI | InChI=1S/C19H18N2O3S/c1-21(2)16-11-10-15-18-14(16)4-3-5-17(18)25(23,24)20-19(15)12-6-8-13(22)9-7-12/h3-11,19-20,22H,1-2H3 |
| InChIKey | RAHOWKGDVTTXED-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |