C15H23ClN2O4S2 — CID 126850171
tert-butyl N-[[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-2-yl]methyl]carbamate (PubChem CID 126850171) has the molecular formula C15H23ClN2O4S2 and a molecular weight of 394.95 g/mol. Its IUPAC name is tert-butyl N-[[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 126850171 |
| Molecular Formula | C15H23ClN2O4S2 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | tert-butyl N-[[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCCN1S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H23ClN2O4S2/c1-15(2,3)22-14(19)17-10-11-6-4-5-9-18(11)24(20,21)13-8-7-12(16)23-13/h7-8,11H,4-6,9-10H2,1-3H3,(H,17,19) |
| InChIKey | SHJPIHIFWHPAOC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |