C19H16N6O2S — CID 126851727
4-pyrazol-1-yl-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]benzenesulfonamide (PubChem CID 126851727) has the molecular formula C19H16N6O2S and a molecular weight of 392.44 g/mol. Its IUPAC name is 4-pyrazol-1-yl-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-pyrazol-1-yl-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 126851727 |
| Molecular Formula | C19H16N6O2S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-pyrazol-1-yl-N-[(3-pyridin-4-ylpyrazin-2-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1nccnc1-c1ccncc1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C19H16N6O2S/c26-28(27,17-4-2-16(3-5-17)25-13-1-8-23-25)24-14-18-19(22-12-11-21-18)15-6-9-20-10-7-15/h1-13,24H,14H2 |
| InChIKey | JLUZJSWGMQKMLE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |