C17H20ClN5 — CID 126893375
1-[1-(3-chloro-4-pyridinyl)azetidin-3-yl]-4-pyridin-2-ylpiperazine (PubChem CID 126893375) has the molecular formula C17H20ClN5 and a molecular weight of 329.83 g/mol. Its IUPAC name is 1-[1-(3-chloro-4-pyridinyl)azetidin-3-yl]-4-pyridin-2-ylpiperazine.
| Compound Name | 1-[1-(3-chloro-4-pyridinyl)azetidin-3-yl]-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 126893375 |
| Molecular Formula | C17H20ClN5 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-[1-(3-chloro-4-pyridinyl)azetidin-3-yl]-4-pyridin-2-ylpiperazine |
| SMILES | Clc1cnccc1N1CC(N2CCN(c3ccccn3)CC2)C1 |
| InChI | InChI=1S/C17H20ClN5/c18-15-11-19-6-4-16(15)23-12-14(13-23)21-7-9-22(10-8-21)17-3-1-2-5-20-17/h1-6,11,14H,7-10,12-13H2 |
| InChIKey | MMMKGLUQRMDUKL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |