C20H20N4O3S — CID 126894227
6-[4-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazin-1-yl]quinazoline (PubChem CID 126894227) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 6-[4-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazin-1-yl]quinazoline.
| Compound Name | 6-[4-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 126894227 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 6-[4-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)piperazin-1-yl]quinazoline |
| SMILES | O=S(=O)(c1ccc2c(c1)CCO2)N1CCN(c2ccc3ncncc3c2)CC1 |
| InChI | InChI=1S/C20H20N4O3S/c25-28(26,18-2-4-20-15(12-18)5-10-27-20)24-8-6-23(7-9-24)17-1-3-19-16(11-17)13-21-14-22-19/h1-4,11-14H,5-10H2 |
| InChIKey | WLFNDRGIKXNWGS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |