C18H21N7O — CID 126911281
12-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 126911281) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is 12-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 12-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 126911281 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 12-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | COc1ccnc(N2CCC(c3nnc4cc5c(nn34)CCC5)CC2)n1 |
| InChI | InChI=1S/C18H21N7O/c1-26-16-5-8-19-18(20-16)24-9-6-12(7-10-24)17-22-21-15-11-13-3-2-4-14(13)23-25(15)17/h5,8,11-12H,2-4,6-7,9-10H2,1H3 |
| InChIKey | LHVJHVNYQGTEAP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |