C17H21N7OS — CID 126911405
2-(methoxymethyl)-5-[4-(1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-12-yl)piperidin-1-yl]-1,3,4-thiadiazole (PubChem CID 126911405) has the molecular formula C17H21N7OS and a molecular weight of 371.47 g/mol. Its IUPAC name is 2-(methoxymethyl)-5-[4-(1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-12-yl)piperidin-1-yl]-1,3,4-thiadiazole.
| Compound Name | 2-(methoxymethyl)-5-[4-(1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-12-yl)piperidin-1-yl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 126911405 |
| Molecular Formula | C17H21N7OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-(methoxymethyl)-5-[4-(1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-12-yl)piperidin-1-yl]-1,3,4-thiadiazole |
| SMILES | COCc1nnc(N2CCC(c3nnc4cc5c(nn34)CCC5)CC2)s1 |
| InChI | InChI=1S/C17H21N7OS/c1-25-10-15-19-21-17(26-15)23-7-5-11(6-8-23)16-20-18-14-9-12-3-2-4-13(12)22-24(14)16/h9,11H,2-8,10H2,1H3 |
| InChIKey | BTHPTYUTYTZPDL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |