C17H19N7 — CID 126911401
12-(1-pyrimidin-4-ylpiperidin-4-yl)-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 126911401) has the molecular formula C17H19N7 and a molecular weight of 321.39 g/mol. Its IUPAC name is 12-(1-pyrimidin-4-ylpiperidin-4-yl)-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 12-(1-pyrimidin-4-ylpiperidin-4-yl)-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 126911401 |
| Molecular Formula | C17H19N7 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 12-(1-pyrimidin-4-ylpiperidin-4-yl)-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | c1cc(N2CCC(c3nnc4cc5c(nn34)CCC5)CC2)ncn1 |
| InChI | InChI=1S/C17H19N7/c1-2-13-10-16-20-21-17(24(16)22-14(13)3-1)12-5-8-23(9-6-12)15-4-7-18-11-19-15/h4,7,10-12H,1-3,5-6,8-9H2 |
| InChIKey | SITUPJLNUDALAZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 72.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |