C21H27N7 — CID 126911272
12-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene (PubChem CID 126911272) has the molecular formula C21H27N7 and a molecular weight of 377.50 g/mol. Its IUPAC name is 12-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene.
| Compound Name | 12-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
|---|---|
| PubChem CID | 126911272 |
| Molecular Formula | C21H27N7 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 12-[1-(6-tert-butylpyridazin-3-yl)piperidin-4-yl]-1,2,10,11-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraene |
| SMILES | CC(C)(C)c1ccc(N2CCC(c3nnc4cc5c(nn34)CCC5)CC2)nn1 |
| InChI | InChI=1S/C21H27N7/c1-21(2,3)17-7-8-18(23-22-17)27-11-9-14(10-12-27)20-25-24-19-13-15-5-4-6-16(15)26-28(19)20/h7-8,13-14H,4-6,9-12H2,1-3H3 |
| InChIKey | UXWBYLISRXCIRM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |