C8H13Cl2O3P — CID 12691473
(1Z)-1,2-dichloro-3-diethoxyphosphorylbuta-1,3-diene (PubChem CID 12691473) has the molecular formula C8H13Cl2O3P and a molecular weight of 259.07 g/mol. Its IUPAC name is (1Z)-1,2-dichloro-3-diethoxyphosphorylbuta-1,3-diene.
| Compound Name | (1Z)-1,2-dichloro-3-diethoxyphosphorylbuta-1,3-diene |
|---|---|
| PubChem CID | 12691473 |
| Molecular Formula | C8H13Cl2O3P |
| Molecular Weight | 259.07 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | (1Z)-1,2-dichloro-3-diethoxyphosphorylbuta-1,3-diene |
| SMILES | C=C(/C(Cl)=C/Cl)P(=O)(OCC)OCC |
| InChI | InChI=1S/C8H13Cl2O3P/c1-4-12-14(11,13-5-2)7(3)8(10)6-9/h6H,3-5H2,1-2H3/b8-6- |
| InChIKey | QWKAGVSJGTUEEQ-VURMDHGXSA-N |
| XLogP | 4.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.07 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|