C18H28NO3+ — CID 126957324
5-(1-hydroxypyridin-1-ium-4-yl)-2,2,8,8-tetramethylnonane-3,7-dione (PubChem CID 126957324) has the molecular formula C18H28NO3+ and a molecular weight of 306.43 g/mol. Its IUPAC name is 5-(1-hydroxypyridin-1-ium-4-yl)-2,2,8,8-tetramethylnonane-3,7-dione.
| Compound Name | 5-(1-hydroxypyridin-1-ium-4-yl)-2,2,8,8-tetramethylnonane-3,7-dione |
|---|---|
| PubChem CID | 126957324 |
| Molecular Formula | C18H28NO3+ |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 5-(1-hydroxypyridin-1-ium-4-yl)-2,2,8,8-tetramethylnonane-3,7-dione |
| SMILES | CC(C)(C)C(=O)CC(CC(=O)C(C)(C)C)c1cc[n+](O)cc1 |
| InChI | InChI=1S/C18H28NO3/c1-17(2,3)15(20)11-14(12-16(21)18(4,5)6)13-7-9-19(22)10-8-13/h7-10,14,22H,11-12H2,1-6H3/q+1 |
| InChIKey | OATPRYDYHMDJRG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|