About 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide
1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide (PubChem CID 126959424) has the molecular formula C14H15Br3NO2+
and a molecular weight of 468.99 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide.
Molecular Properties
| Compound Name | 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide |
| PubChem CID | 126959424 |
| Molecular Formula | C14H15Br3NO2+ |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 465.86 |
| IUPAC Name | 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide |
| SMILES | Br.CC(C(=O)c1ccc(Br)cc1)[n+]1cccc(Br)c1.O |
| InChI | InChI=1S/C14H12Br2NO.BrH.H2O/c1-10(17-8-2-3-13(16)9-17)14(18)11-4-6-12(15)7-5-11;;/h2-10H,1H3;1H;1H2/q+1;; |
| InChIKey | PGOVBZCGNLHPGK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide?
The IUPAC name of 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide (CID 126959424) is 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide.
What is the SMILES notation for 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide?
The canonical SMILES for 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide is Br.CC(C(=O)c1ccc(Br)cc1)[n+]1cccc(Br)c1.O.
What is the InChIKey of 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide?
The InChIKey is PGOVBZCGNLHPGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Br2NO.BrH.H2O/c1-10(17-8-2-3-13(16)9-17)14(18)11-4-6-12(15)7-5-11;;/h2-10H,1H3;1H;1H2/q+1;;.
What are the key properties of 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide?
1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide has a molecular weight of 468.99 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromophenyl)-2-(3-bromopyridin-1-ium-1-yl)propan-1-one;hydrate;hydrobromide is sourced from PubChem (CID 126959424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).