C8H11IN2OS — CID 126983724
[5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanamine (PubChem CID 126983724) has the molecular formula C8H11IN2OS and a molecular weight of 310.16 g/mol. Its IUPAC name is [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanamine.
| Compound Name | [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 126983724 |
| Molecular Formula | C8H11IN2OS |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanamine |
| SMILES | NCC1CCC(c2ncc(I)s2)O1 |
| InChI | InChI=1S/C8H11IN2OS/c9-7-4-11-8(13-7)6-2-1-5(3-10)12-6/h4-6H,1-3,10H2 |
| InChIKey | TZPLSHXUDFEFEX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|