C8H9I2NOS — CID 130583464
5-iodo-2-[5-(iodomethyl)oxolan-2-yl]-1,3-thiazole (PubChem CID 130583464) has the molecular formula C8H9I2NOS and a molecular weight of 421.04 g/mol. Its IUPAC name is 5-iodo-2-[5-(iodomethyl)oxolan-2-yl]-1,3-thiazole.
| Compound Name | 5-iodo-2-[5-(iodomethyl)oxolan-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 130583464 |
| Molecular Formula | C8H9I2NOS |
| Molecular Weight | 421.04 g/mol |
| Exact Mass | 420.85 |
| IUPAC Name | 5-iodo-2-[5-(iodomethyl)oxolan-2-yl]-1,3-thiazole |
| SMILES | ICC1CCC(c2ncc(I)s2)O1 |
| InChI | InChI=1S/C8H9I2NOS/c9-3-5-1-2-6(12-5)8-11-4-7(10)13-8/h4-6H,1-3H2 |
| InChIKey | MAMITLLPVHFXHL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.04 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|