C7H6Br2F2OS — CID 126985854
1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-ol (PubChem CID 126985854) has the molecular formula C7H6Br2F2OS and a molecular weight of 336.00 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-ol.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 126985854 |
| Molecular Formula | C7H6Br2F2OS |
| Molecular Weight | 336.00 g/mol |
| Exact Mass | 333.85 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2,2-difluoropropan-1-ol |
| SMILES | CC(F)(F)C(O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C7H6Br2F2OS/c1-7(10,11)5(12)3-2-4(8)13-6(3)9/h2,5,12H,1H3 |
| InChIKey | HUDVZNRKTXUURS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.00 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |