C10H19NS — CID 126985980
5-cyclobutyl-3,3-dimethylthiomorpholine (PubChem CID 126985980) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is 5-cyclobutyl-3,3-dimethylthiomorpholine.
| Compound Name | 5-cyclobutyl-3,3-dimethylthiomorpholine |
|---|---|
| PubChem CID | 126985980 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 5-cyclobutyl-3,3-dimethylthiomorpholine |
| SMILES | CC1(C)CSCC(C2CCC2)N1 |
| InChI | InChI=1S/C10H19NS/c1-10(2)7-12-6-9(11-10)8-4-3-5-8/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | USSITMNEDRTXJS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |