C8H17NOS — CID 107511181
5-(methoxymethyl)-3,3-dimethylthiomorpholine (PubChem CID 107511181) has the molecular formula C8H17NOS and a molecular weight of 175.30 g/mol. Its IUPAC name is 5-(methoxymethyl)-3,3-dimethylthiomorpholine.
| Compound Name | 5-(methoxymethyl)-3,3-dimethylthiomorpholine |
|---|---|
| PubChem CID | 107511181 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 5-(methoxymethyl)-3,3-dimethylthiomorpholine |
| SMILES | COCC1CSCC(C)(C)N1 |
| InChI | InChI=1S/C8H17NOS/c1-8(2)6-11-5-7(9-8)4-10-3/h7,9H,4-6H2,1-3H3 |
| InChIKey | WFCOCIVQUWYEFQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |