C6H13NO — CID 135013065
3-(methoxymethyl)-2,2-dimethylaziridine (PubChem CID 135013065) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is 3-(methoxymethyl)-2,2-dimethylaziridine.
| Compound Name | 3-(methoxymethyl)-2,2-dimethylaziridine |
|---|---|
| PubChem CID | 135013065 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | 3-(methoxymethyl)-2,2-dimethylaziridine |
| SMILES | COCC1NC1(C)C |
| InChI | InChI=1S/C6H13NO/c1-6(2)5(7-6)4-8-3/h5,7H,4H2,1-3H3 |
| InChIKey | HQGWZLLKJUKKEQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 31.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|