C9H18O6 — CID 163692364
2,4,6-tris(methoxymethyl)-1,3,5-trioxane (PubChem CID 163692364) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2,4,6-tris(methoxymethyl)-1,3,5-trioxane.
| Compound Name | 2,4,6-tris(methoxymethyl)-1,3,5-trioxane |
|---|---|
| PubChem CID | 163692364 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2,4,6-tris(methoxymethyl)-1,3,5-trioxane |
| SMILES | COCC1OC(COC)OC(COC)O1 |
| InChI | InChI=1S/C9H18O6/c1-10-4-7-13-8(5-11-2)15-9(14-7)6-12-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | JUAYBKIDCFRYII-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |