C10H20N4 — CID 126997137
2-(1-piperazin-1-ylethyl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 126997137) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 2-(1-piperazin-1-ylethyl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(1-piperazin-1-ylethyl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 126997137 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 2-(1-piperazin-1-ylethyl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | CC(C1=NCCCN1)N1CCNCC1 |
| InChI | InChI=1S/C10H20N4/c1-9(10-12-3-2-4-13-10)14-7-5-11-6-8-14/h9,11H,2-8H2,1H3,(H,12,13) |
| InChIKey | QKOKMZQOJYITBT-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |