C11H21NS — CID 127003744
3-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)propane-1-thiol (PubChem CID 127003744) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is 3-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)propane-1-thiol.
| Compound Name | 3-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)propane-1-thiol |
|---|---|
| PubChem CID | 127003744 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 3-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)propane-1-thiol |
| SMILES | SCCCN1CC2CCCCC2C1 |
| InChI | InChI=1S/C11H21NS/c13-7-3-6-12-8-10-4-1-2-5-11(10)9-12/h10-11,13H,1-9H2 |
| InChIKey | LNTDRXTUSXRIMQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|