C16H33ClN2 — CID 54609763
4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-diethylbutan-1-amine;hydrochloride (PubChem CID 54609763) has the molecular formula C16H33ClN2 and a molecular weight of 288.91 g/mol. Its IUPAC name is 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-diethylbutan-1-amine;hydrochloride.
| Compound Name | 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-diethylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 54609763 |
| Molecular Formula | C16H33ClN2 |
| Molecular Weight | 288.91 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 4-(1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)-N,N-diethylbutan-1-amine;hydrochloride |
| SMILES | CCN(CC)CCCCN1CC2CCCCC2C1.Cl |
| InChI | InChI=1S/C16H32N2.ClH/c1-3-17(4-2)11-7-8-12-18-13-15-9-5-6-10-16(15)14-18;/h15-16H,3-14H2,1-2H3;1H |
| InChIKey | VZFTXLVDLPGJQM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.91 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|