C20H25F3N4O2S — CID 127021285
N-[[(3aR,4R,7aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]pyridin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 127021285) has the molecular formula C20H25F3N4O2S and a molecular weight of 442.51 g/mol. Its IUPAC name is N-[[(3aR,4R,7aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]pyridin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3aR,4R,7aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]pyridin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021285 |
| Molecular Formula | C20H25F3N4O2S |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[[(3aR,4R,7aS)-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]pyridin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc(NC[C@@H]2CCC[C@@H]3CN(Cc4nccs4)C[C@@H]32)nc1 |
| InChI | InChI=1S/C18H24N4S.C2HF3O2/c1-2-7-19-17(6-1)21-10-14-4-3-5-15-11-22(12-16(14)15)13-18-20-8-9-23-18;3-2(4,5)1(6)7/h1-2,6-9,14-16H,3-5,10-13H2,(H,19,21);(H,6,7)/t14-,15+,16+;/m0./s1 |
| InChIKey | GHKDLDRBMDABII-FUQNERGOSA-N |
| XLogP | 4.13 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |