C20H30F6N4O4S — CID 127021648
N-[[(3aR,4R,7aS)-2-(thiadiazol-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methylpropan-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 127021648) has the molecular formula C20H30F6N4O4S and a molecular weight of 536.54 g/mol. Its IUPAC name is N-[[(3aR,4R,7aS)-2-(thiadiazol-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methylpropan-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[[(3aR,4R,7aS)-2-(thiadiazol-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methylpropan-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 127021648 |
| Molecular Formula | C20H30F6N4O4S |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | N-[[(3aR,4R,7aS)-2-(thiadiazol-4-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl]methyl]-2-methylpropan-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)(C)NC[C@@H]1CCC[C@@H]2CN(Cc3csnn3)C[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H28N4S.2C2HF3O2/c1-16(2,3)17-7-12-5-4-6-13-8-20(10-15(12)13)9-14-11-21-19-18-14;2*3-2(4,5)1(6)7/h11-13,15,17H,4-10H2,1-3H3;2*(H,6,7)/t12-,13+,15+;;/m0../s1 |
| InChIKey | PBKHVFCUIMGHAD-NEGDTNHASA-N |
| XLogP | 4.04 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |