C23H32F3N3O4 — CID 127022200
(3aR,8aR)-1-ethyl-N,N-dimethyl-6-(2-phenylacetyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 127022200) has the molecular formula C23H32F3N3O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is (3aR,8aR)-1-ethyl-N,N-dimethyl-6-(2-phenylacetyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,8aR)-1-ethyl-N,N-dimethyl-6-(2-phenylacetyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127022200 |
| Molecular Formula | C23H32F3N3O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | (3aR,8aR)-1-ethyl-N,N-dimethyl-6-(2-phenylacetyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepine-3a-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CC[C@@]2(C(=O)N(C)C)CCN(C(=O)Cc3ccccc3)CC[C@@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H31N3O2.C2HF3O2/c1-4-23-14-11-21(20(26)22(2)3)12-15-24(13-10-18(21)23)19(25)16-17-8-6-5-7-9-17;3-2(4,5)1(6)7/h5-9,18H,4,10-16H2,1-3H3;(H,6,7)/t18-,21-;/m1./s1 |
| InChIKey | GYKOYIHJPHLOKW-IUFJOMBNSA-N |
| XLogP | 2.65 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |