C18H27N3O — CID 97404291
(3aS,7aR)-1-ethyl-N,N-dimethyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine-6-carboxamide (PubChem CID 97404291) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is (3aS,7aR)-1-ethyl-N,N-dimethyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine-6-carboxamide.
| Compound Name | (3aS,7aR)-1-ethyl-N,N-dimethyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 97404291 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | (3aS,7aR)-1-ethyl-N,N-dimethyl-3a-phenyl-2,3,4,5,7,7a-hexahydropyrrolo[2,3-c]pyridine-6-carboxamide |
| SMILES | CCN1CC[C@@]2(c3ccccc3)CCN(C(=O)N(C)C)C[C@H]12 |
| InChI | InChI=1S/C18H27N3O/c1-4-20-12-10-18(15-8-6-5-7-9-15)11-13-21(14-16(18)20)17(22)19(2)3/h5-9,16H,4,10-14H2,1-3H3/t16-,18-/m0/s1 |
| InChIKey | ILBFFHGIWYITEZ-WMZOPIPTSA-N |
| XLogP | 2.41 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |