C12H14N2O — CID 12702480
2-benzyl-1,5-dimethylpyrazol-3-one (PubChem CID 12702480) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-benzyl-1,5-dimethylpyrazol-3-one.
| Compound Name | 2-benzyl-1,5-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 12702480 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-benzyl-1,5-dimethylpyrazol-3-one |
| SMILES | Cc1cc(=O)n(Cc2ccccc2)n1C |
| InChI | InChI=1S/C12H14N2O/c1-10-8-12(15)14(13(10)2)9-11-6-4-3-5-7-11/h3-8H,9H2,1-2H3 |
| InChIKey | PZVABTDZSMWDPM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |