C25H30N8O3 — CID 127025342
2-[6-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-7-methoxyquinazolin-4-yl]-5-pyridin-2-yl-1,2,4-triazol-3-amine (PubChem CID 127025342) has the molecular formula C25H30N8O3 and a molecular weight of 490.57 g/mol. Its IUPAC name is 2-[6-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-7-methoxyquinazolin-4-yl]-5-pyridin-2-yl-1,2,4-triazol-3-amine.
| Compound Name | 2-[6-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-7-methoxyquinazolin-4-yl]-5-pyridin-2-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 127025342 |
| Molecular Formula | C25H30N8O3 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 2-[6-[3-(2,6-dimethylmorpholin-4-yl)propoxy]-7-methoxyquinazolin-4-yl]-5-pyridin-2-yl-1,2,4-triazol-3-amine |
| SMILES | COc1cc2ncnc(-n3nc(-c4ccccn4)nc3N)c2cc1OCCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C25H30N8O3/c1-16-13-32(14-17(2)36-16)9-6-10-35-22-11-18-20(12-21(22)34-3)28-15-29-24(18)33-25(26)30-23(31-33)19-7-4-5-8-27-19/h4-5,7-8,11-12,15-17H,6,9-10,13-14H2,1-3H3,(H2,26,30,31) |
| InChIKey | OVVVCCFJRNGOFS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 126.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|