C15H14N4OS3 — CID 127028456
2-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 127028456) has the molecular formula C15H14N4OS3 and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate.
| Compound Name | 2-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 127028456 |
| Molecular Formula | C15H14N4OS3 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 2-(5-thiophen-3-yl-1,3,4-oxadiazol-2-yl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | S=C(NCc1cccnc1)SCCc1nnc(-c2ccsc2)o1 |
| InChI | InChI=1S/C15H14N4OS3/c21-15(17-9-11-2-1-5-16-8-11)23-7-4-13-18-19-14(20-13)12-3-6-22-10-12/h1-3,5-6,8,10H,4,7,9H2,(H,17,21) |
| InChIKey | OJEJGSRZTZJBOH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|