C26H33NO4 — CID 127028535
[4-[2-[(2S,6R)-6-[2-(4-acetyloxyphenyl)ethyl]-1-methylpiperidin-2-yl]ethyl]phenyl] acetate (PubChem CID 127028535) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is [4-[2-[(2S,6R)-6-[2-(4-acetyloxyphenyl)ethyl]-1-methylpiperidin-2-yl]ethyl]phenyl] acetate.
| Compound Name | [4-[2-[(2S,6R)-6-[2-(4-acetyloxyphenyl)ethyl]-1-methylpiperidin-2-yl]ethyl]phenyl] acetate |
|---|---|
| PubChem CID | 127028535 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | [4-[2-[(2S,6R)-6-[2-(4-acetyloxyphenyl)ethyl]-1-methylpiperidin-2-yl]ethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(CC[C@H]2CCC[C@@H](CCc3ccc(OC(C)=O)cc3)N2C)cc1 |
| InChI | InChI=1S/C26H33NO4/c1-19(28)30-25-15-9-21(10-16-25)7-13-23-5-4-6-24(27(23)3)14-8-22-11-17-26(18-12-22)31-20(2)29/h9-12,15-18,23-24H,4-8,13-14H2,1-3H3/t23-,24+ |
| InChIKey | GRFPEIGLBZLKER-PSWAGMNNSA-N |
| XLogP | 4.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|