C15H20NO5PS2 — CID 127029508
[2-methyl-1-[[4-(5-methylthiophen-2-yl)phenyl]sulfonylamino]propyl]phosphonic acid (PubChem CID 127029508) has the molecular formula C15H20NO5PS2 and a molecular weight of 389.44 g/mol. Its IUPAC name is [2-methyl-1-[[4-(5-methylthiophen-2-yl)phenyl]sulfonylamino]propyl]phosphonic acid.
| Compound Name | [2-methyl-1-[[4-(5-methylthiophen-2-yl)phenyl]sulfonylamino]propyl]phosphonic acid |
|---|---|
| PubChem CID | 127029508 |
| Molecular Formula | C15H20NO5PS2 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [2-methyl-1-[[4-(5-methylthiophen-2-yl)phenyl]sulfonylamino]propyl]phosphonic acid |
| SMILES | Cc1ccc(-c2ccc(S(=O)(=O)NC(C(C)C)P(=O)(O)O)cc2)s1 |
| InChI | InChI=1S/C15H20NO5PS2/c1-10(2)15(22(17,18)19)16-24(20,21)13-7-5-12(6-8-13)14-9-4-11(3)23-14/h4-10,15-16H,1-3H3,(H2,17,18,19) |
| InChIKey | VKONUXHCJZOMEM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|