C20H16ClNO5S — CID 127031171
2-[1-[[2-(benzenesulfonyl)phenyl]methyl]-5-chloro-6-oxo-3-pyridinyl]acetic acid (PubChem CID 127031171) has the molecular formula C20H16ClNO5S and a molecular weight of 417.87 g/mol. Its IUPAC name is 2-[1-[[2-(benzenesulfonyl)phenyl]methyl]-5-chloro-6-oxo-3-pyridinyl]acetic acid.
| Compound Name | 2-[1-[[2-(benzenesulfonyl)phenyl]methyl]-5-chloro-6-oxo-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 127031171 |
| Molecular Formula | C20H16ClNO5S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 2-[1-[[2-(benzenesulfonyl)phenyl]methyl]-5-chloro-6-oxo-3-pyridinyl]acetic acid |
| SMILES | O=C(O)Cc1cc(Cl)c(=O)n(Cc2ccccc2S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H16ClNO5S/c21-17-10-14(11-19(23)24)12-22(20(17)25)13-15-6-4-5-9-18(15)28(26,27)16-7-2-1-3-8-16/h1-10,12H,11,13H2,(H,23,24) |
| InChIKey | FHBRXEDHBXYISA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |