C13H17F2N3O3 — CID 127037876
(2S)-2-[(2,4-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide (PubChem CID 127037876) has the molecular formula C13H17F2N3O3 and a molecular weight of 301.29 g/mol. Its IUPAC name is (2S)-2-[(2,4-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide.
| Compound Name | (2S)-2-[(2,4-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 127037876 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (2S)-2-[(2,4-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)Nc1ccc(F)cc1F)C(=O)NO |
| InChI | InChI=1S/C13H17F2N3O3/c1-7(2)5-11(12(19)18-21)17-13(20)16-10-4-3-8(14)6-9(10)15/h3-4,6-7,11,21H,5H2,1-2H3,(H,18,19)(H2,16,17,20)/t11-/m0/s1 |
| InChIKey | NVIUWXLGDPUJQC-NSHDSACASA-N |
| XLogP | 2.01 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|