C26H24N2O4 — CID 127038546
[(2R)-3-(benzylamino)-3-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]propyl] benzoate (PubChem CID 127038546) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is [(2R)-3-(benzylamino)-3-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]propyl] benzoate.
| Compound Name | [(2R)-3-(benzylamino)-3-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]propyl] benzoate |
|---|---|
| PubChem CID | 127038546 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [(2R)-3-(benzylamino)-3-oxo-2-[[(E)-3-phenylprop-2-enoyl]amino]propyl] benzoate |
| SMILES | O=C(/C=C/c1ccccc1)N[C@H](COC(=O)c1ccccc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H24N2O4/c29-24(17-16-20-10-4-1-5-11-20)28-23(19-32-26(31)22-14-8-3-9-15-22)25(30)27-18-21-12-6-2-7-13-21/h1-17,23H,18-19H2,(H,27,30)(H,28,29)/b17-16+/t23-/m1/s1 |
| InChIKey | MBQVFBISGPCZCL-KXKTWFEWSA-N |
| XLogP | 3.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|