C28H34N2O7 — CID 127041947
[(2S)-3-(cyclohexylamino)-3-oxo-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propyl] benzoate (PubChem CID 127041947) has the molecular formula C28H34N2O7 and a molecular weight of 510.59 g/mol. Its IUPAC name is [(2S)-3-(cyclohexylamino)-3-oxo-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propyl] benzoate.
| Compound Name | [(2S)-3-(cyclohexylamino)-3-oxo-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propyl] benzoate |
|---|---|
| PubChem CID | 127041947 |
| Molecular Formula | C28H34N2O7 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | [(2S)-3-(cyclohexylamino)-3-oxo-2-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]propyl] benzoate |
| SMILES | COc1cc(/C=C/C(=O)N[C@@H](COC(=O)c2ccccc2)C(=O)NC2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C28H34N2O7/c1-34-23-16-19(17-24(35-2)26(23)36-3)14-15-25(31)30-22(27(32)29-21-12-8-5-9-13-21)18-37-28(33)20-10-6-4-7-11-20/h4,6-7,10-11,14-17,21-22H,5,8-9,12-13,18H2,1-3H3,(H,29,32)(H,30,31)/b15-14+/t22-/m0/s1 |
| InChIKey | WEJVBJYWAKVTSN-FRFYRWIFSA-N |
| XLogP | 3.52 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|