C24H37N3O4S — CID 118181372
(E)-N-[1-(cyclohexylcarbamothioylamino)-3-methylbutyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 118181372) has the molecular formula C24H37N3O4S and a molecular weight of 463.64 g/mol. Its IUPAC name is (E)-N-[1-(cyclohexylcarbamothioylamino)-3-methylbutyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-(cyclohexylcarbamothioylamino)-3-methylbutyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 118181372 |
| Molecular Formula | C24H37N3O4S |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | (E)-N-[1-(cyclohexylcarbamothioylamino)-3-methylbutyl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC(CC(C)C)NC(=S)NC2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H37N3O4S/c1-16(2)13-21(27-24(32)25-18-9-7-6-8-10-18)26-22(28)12-11-17-14-19(29-3)23(31-5)20(15-17)30-4/h11-12,14-16,18,21H,6-10,13H2,1-5H3,(H,26,28)(H2,25,27,32)/b12-11+ |
| InChIKey | LYJIAGKKXYNOGE-VAWYXSNFSA-N |
| XLogP | 4.01 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|