C19H18O3S — CID 127038585
3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene (PubChem CID 127038585) has the molecular formula C19H18O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is 3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene.
| Compound Name | 3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene |
|---|---|
| PubChem CID | 127038585 |
| Molecular Formula | C19H18O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1-benzothiophene |
| SMILES | COc1cc(/C=C\c2csc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C19H18O3S/c1-20-16-10-13(11-17(21-2)19(16)22-3)8-9-14-12-23-18-7-5-4-6-15(14)18/h4-12H,1-3H3/b9-8- |
| InChIKey | FGXWQSWXZKTWIY-HJWRWDBZSA-N |
| XLogP | 5.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |