C25H21F2NO2 — CID 127038794
1-[7-fluoro-2-(4-fluorophenyl)-3-(4-methoxyphenyl)-1H-isoquinolin-1-yl]propan-2-one (PubChem CID 127038794) has the molecular formula C25H21F2NO2 and a molecular weight of 405.44 g/mol. Its IUPAC name is 1-[7-fluoro-2-(4-fluorophenyl)-3-(4-methoxyphenyl)-1H-isoquinolin-1-yl]propan-2-one.
| Compound Name | 1-[7-fluoro-2-(4-fluorophenyl)-3-(4-methoxyphenyl)-1H-isoquinolin-1-yl]propan-2-one |
|---|---|
| PubChem CID | 127038794 |
| Molecular Formula | C25H21F2NO2 |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-[7-fluoro-2-(4-fluorophenyl)-3-(4-methoxyphenyl)-1H-isoquinolin-1-yl]propan-2-one |
| SMILES | COc1ccc(C2=Cc3ccc(F)cc3C(CC(C)=O)N2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H21F2NO2/c1-16(29)13-25-23-15-20(27)6-3-18(23)14-24(17-4-11-22(30-2)12-5-17)28(25)21-9-7-19(26)8-10-21/h3-12,14-15,25H,13H2,1-2H3 |
| InChIKey | PNXWGAKEFPIVDK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|