C27H26FNO3 — CID 127041136
1-[7-fluoro-3-(4-methoxyphenyl)-2-(4-methylphenyl)-1H-isoquinolin-1-yl]-3-hydroxybutan-2-one (PubChem CID 127041136) has the molecular formula C27H26FNO3 and a molecular weight of 431.51 g/mol. Its IUPAC name is 1-[7-fluoro-3-(4-methoxyphenyl)-2-(4-methylphenyl)-1H-isoquinolin-1-yl]-3-hydroxybutan-2-one.
| Compound Name | 1-[7-fluoro-3-(4-methoxyphenyl)-2-(4-methylphenyl)-1H-isoquinolin-1-yl]-3-hydroxybutan-2-one |
|---|---|
| PubChem CID | 127041136 |
| Molecular Formula | C27H26FNO3 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 1-[7-fluoro-3-(4-methoxyphenyl)-2-(4-methylphenyl)-1H-isoquinolin-1-yl]-3-hydroxybutan-2-one |
| SMILES | COc1ccc(C2=Cc3ccc(F)cc3C(CC(=O)C(C)O)N2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H26FNO3/c1-17-4-10-22(11-5-17)29-25(19-7-12-23(32-3)13-8-19)14-20-6-9-21(28)15-24(20)26(29)16-27(31)18(2)30/h4-15,18,26,30H,16H2,1-3H3 |
| InChIKey | ONYNORWTJFXYGA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|