C26H23ClFNO3 — CID 127041449
1-[2-(4-chlorophenyl)-7-fluoro-3-(4-methoxyphenyl)-1H-isoquinolin-1-yl]-3-hydroxybutan-2-one (PubChem CID 127041449) has the molecular formula C26H23ClFNO3 and a molecular weight of 451.93 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-7-fluoro-3-(4-methoxyphenyl)-1H-isoquinolin-1-yl]-3-hydroxybutan-2-one.
| Compound Name | 1-[2-(4-chlorophenyl)-7-fluoro-3-(4-methoxyphenyl)-1H-isoquinolin-1-yl]-3-hydroxybutan-2-one |
|---|---|
| PubChem CID | 127041449 |
| Molecular Formula | C26H23ClFNO3 |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-7-fluoro-3-(4-methoxyphenyl)-1H-isoquinolin-1-yl]-3-hydroxybutan-2-one |
| SMILES | COc1ccc(C2=Cc3ccc(F)cc3C(CC(=O)C(C)O)N2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H23ClFNO3/c1-16(30)26(31)15-25-23-14-20(28)8-3-18(23)13-24(17-4-11-22(32-2)12-5-17)29(25)21-9-6-19(27)7-10-21/h3-14,16,25,30H,15H2,1-2H3 |
| InChIKey | KQZOLAYKJPSVKV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|