C29H26FNO3 — CID 156602580
1-[7-fluoro-2-[4-(4-hydroxybut-1-ynyl)phenyl]-3-(3-methoxyphenyl)-1H-isoquinolin-1-yl]propan-2-one (PubChem CID 156602580) has the molecular formula C29H26FNO3 and a molecular weight of 455.53 g/mol. Its IUPAC name is 1-[7-fluoro-2-[4-(4-hydroxybut-1-ynyl)phenyl]-3-(3-methoxyphenyl)-1H-isoquinolin-1-yl]propan-2-one.
| Compound Name | 1-[7-fluoro-2-[4-(4-hydroxybut-1-ynyl)phenyl]-3-(3-methoxyphenyl)-1H-isoquinolin-1-yl]propan-2-one |
|---|---|
| PubChem CID | 156602580 |
| Molecular Formula | C29H26FNO3 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 1-[7-fluoro-2-[4-(4-hydroxybut-1-ynyl)phenyl]-3-(3-methoxyphenyl)-1H-isoquinolin-1-yl]propan-2-one |
| SMILES | COc1cccc(C2=Cc3ccc(F)cc3C(CC(C)=O)N2c2ccc(C#CCCO)cc2)c1 |
| InChI | InChI=1S/C29H26FNO3/c1-20(33)16-29-27-19-24(30)12-11-22(27)18-28(23-7-5-8-26(17-23)34-2)31(29)25-13-9-21(10-14-25)6-3-4-15-32/h5,7-14,17-19,29,32H,4,15-16H2,1-2H3 |
| InChIKey | YMUDWFTWZHHDLL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|