C21H36O3Si — CID 127041838
(1S,5R,8R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-8-methyl-4-propan-2-ylspiro[4.5]deca-3,9-dien-2-one (PubChem CID 127041838) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (1S,5R,8R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-8-methyl-4-propan-2-ylspiro[4.5]deca-3,9-dien-2-one.
| Compound Name | (1S,5R,8R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-8-methyl-4-propan-2-ylspiro[4.5]deca-3,9-dien-2-one |
|---|---|
| PubChem CID | 127041838 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (1S,5R,8R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-8-hydroxy-8-methyl-4-propan-2-ylspiro[4.5]deca-3,9-dien-2-one |
| SMILES | CC(C)C1=CC(=O)[C@H](CO[Si](C)(C)C(C)(C)C)[C@@]12C=C[C@](C)(O)CC2 |
| InChI | InChI=1S/C21H36O3Si/c1-15(2)16-13-18(22)17(14-24-25(7,8)19(3,4)5)21(16)11-9-20(6,23)10-12-21/h9,11,13,15,17,23H,10,12,14H2,1-8H3/t17-,20-,21+/m0/s1 |
| InChIKey | PQTHMEBRSAXTAA-DZFGPLHGSA-N |
| XLogP | 4.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|