C33H54O6Si — CID 135068880
6-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxypropan-2-yl)but-2-enyl]-3,5-dihydroxy-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one (PubChem CID 135068880) has the molecular formula C33H54O6Si and a molecular weight of 574.88 g/mol. Its IUPAC name is 6-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxypropan-2-yl)but-2-enyl]-3,5-dihydroxy-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 6-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxypropan-2-yl)but-2-enyl]-3,5-dihydroxy-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 135068880 |
| Molecular Formula | C33H54O6Si |
| Molecular Weight | 574.88 g/mol |
| Exact Mass | 574.37 |
| IUPAC Name | 6-[(Z)-4-[tert-butyl(dimethyl)silyl]oxy-2-(2-hydroxypropan-2-yl)but-2-enyl]-3,5-dihydroxy-4,6-bis(3-methylbut-2-enyl)-2-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC(C)=CCC1=C(O)C(CC=C(C)C)(C/C(=C/CO[Si](C)(C)C(C)(C)C)C(C)(C)O)C(=O)C(C(=O)C(C)C)=C1O |
| InChI | InChI=1S/C33H54O6Si/c1-21(2)14-15-25-28(35)26(27(34)23(5)6)30(37)33(29(25)36,18-16-22(3)4)20-24(32(10,11)38)17-19-39-40(12,13)31(7,8)9/h14,16-17,23,35-36,38H,15,18-20H2,1-13H3/b24-17- |
| InChIKey | VIKUITNDHHFUDL-ULJHMMPZSA-N |
| XLogP | 8.23 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.88 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|