C31H40O6 — CID 162888733
(2S,3aS)-6-hydroxy-2-(2-hydroxypropan-2-yl)-5-[3-(4-methoxyphenyl)propanoyl]-3a,7-bis(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one (PubChem CID 162888733) has the molecular formula C31H40O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is (2S,3aS)-6-hydroxy-2-(2-hydroxypropan-2-yl)-5-[3-(4-methoxyphenyl)propanoyl]-3a,7-bis(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one.
| Compound Name | (2S,3aS)-6-hydroxy-2-(2-hydroxypropan-2-yl)-5-[3-(4-methoxyphenyl)propanoyl]-3a,7-bis(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one |
|---|---|
| PubChem CID | 162888733 |
| Molecular Formula | C31H40O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | (2S,3aS)-6-hydroxy-2-(2-hydroxypropan-2-yl)-5-[3-(4-methoxyphenyl)propanoyl]-3a,7-bis(3-methylbut-2-enyl)-2,3-dihydro-1-benzofuran-4-one |
| SMILES | COc1ccc(CCC(=O)C2=C(O)C(CC=C(C)C)=C3O[C@H](C(C)(C)O)C[C@]3(CC=C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C31H40O6/c1-19(2)8-14-23-27(33)26(24(32)15-11-21-9-12-22(36-7)13-10-21)28(34)31(17-16-20(3)4)18-25(30(5,6)35)37-29(23)31/h8-10,12-13,16,25,33,35H,11,14-15,17-18H2,1-7H3/t25-,31+/m0/s1 |
| InChIKey | INTQUHRVFBKVIG-VVFBEHOQSA-N |
| XLogP | 6.10 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|