C21H32O4Si — CID 11234254
(1S,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(3-methylbut-2-enyl)-3-[(E)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 11234254) has the molecular formula C21H32O4Si and a molecular weight of 376.57 g/mol. Its IUPAC name is (1S,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(3-methylbut-2-enyl)-3-[(E)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | (1S,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(3-methylbut-2-enyl)-3-[(E)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 11234254 |
| Molecular Formula | C21H32O4Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (1S,6R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-(3-methylbut-2-enyl)-3-[(E)-prop-1-enyl]-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | C/C=C/C1=C(CO[Si](C)(C)C(C)(C)C)C(=O)[C@@H]2O[C@]2(CC=C(C)C)C1=O |
| InChI | InChI=1S/C21H32O4Si/c1-9-10-15-16(13-24-26(7,8)20(4,5)6)17(22)19-21(25-19,18(15)23)12-11-14(2)3/h9-11,19H,12-13H2,1-8H3/b10-9+/t19-,21+/m0/s1 |
| InChIKey | JBOTUAMPWMJFMK-OQTBQRIBSA-N |
| XLogP | 4.53 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|