C18H24O5 — CID 127042783
ethyl (1S,5R,7S)-7-acetyloxy-8-oxo-4-propan-2-ylspiro[4.5]deca-3,9-diene-1-carboxylate (PubChem CID 127042783) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is ethyl (1S,5R,7S)-7-acetyloxy-8-oxo-4-propan-2-ylspiro[4.5]deca-3,9-diene-1-carboxylate.
| Compound Name | ethyl (1S,5R,7S)-7-acetyloxy-8-oxo-4-propan-2-ylspiro[4.5]deca-3,9-diene-1-carboxylate |
|---|---|
| PubChem CID | 127042783 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | ethyl (1S,5R,7S)-7-acetyloxy-8-oxo-4-propan-2-ylspiro[4.5]deca-3,9-diene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC=C(C(C)C)[C@]12C=CC(=O)[C@@H](OC(C)=O)C2 |
| InChI | InChI=1S/C18H24O5/c1-5-22-17(21)14-7-6-13(11(2)3)18(14)9-8-15(20)16(10-18)23-12(4)19/h6,8-9,11,14,16H,5,7,10H2,1-4H3/t14-,16+,18-/m1/s1 |
| InChIKey | RNBIJAQVOUJNKM-UWWQBHOKSA-N |
| XLogP | 2.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|