C18H13N3O4S — CID 127044196
2-(1,3-benzoxazol-2-ylsulfanyl)-1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)ethanone (PubChem CID 127044196) has the molecular formula C18H13N3O4S and a molecular weight of 367.39 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)ethanone.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)ethanone |
|---|---|
| PubChem CID | 127044196 |
| Molecular Formula | C18H13N3O4S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)ethanone |
| SMILES | Cc1c(C(=O)CSc2nc3ccccc3o2)[n+](=O)c2ccccc2n1[O-] |
| InChI | InChI=1S/C18H13N3O4S/c1-11-17(21(24)14-8-4-3-7-13(14)20(11)23)15(22)10-26-18-19-12-6-2-5-9-16(12)25-18/h2-9H,10H2,1H3 |
| InChIKey | JVYUBXUJBIXLLO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|