C24H26N2O2S2 — CID 127044856
propan-2-yl 2-[(Z)-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 127044856) has the molecular formula C24H26N2O2S2 and a molecular weight of 438.62 g/mol. Its IUPAC name is propan-2-yl 2-[(Z)-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[(Z)-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 127044856 |
| Molecular Formula | C24H26N2O2S2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | propan-2-yl 2-[(Z)-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCn1c(-c2ccccc2)cs/c1=N\c1sc2c(c1C(=O)OC(C)C)CCCC2 |
| InChI | InChI=1S/C24H26N2O2S2/c1-4-14-26-19(17-10-6-5-7-11-17)15-29-24(26)25-22-21(23(27)28-16(2)3)18-12-8-9-13-20(18)30-22/h4-7,10-11,15-16H,1,8-9,12-14H2,2-3H3/b25-24- |
| InChIKey | CSLGDGGTXWIJGV-IZHYLOQSSA-N |
| XLogP | 6.14 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|